The CAS registry number of Propanoic acid,2-hydroxy-, 1-carboxyethyl ester is 617-57-2. This chemical is also named as 2-(Lactoyloxy)propanoic acid. Its EINECS registry number is 210-520-1. In addition, its molecular formula is C₆H₁₀O₅ and molecular weight is 162.1406. Its systematic name and IUPAC name are the same which is called 2-[(2-hydroxypropanoyl)oxy]propanoic acid.

Physical properties about Propanoic acid,2-hydroxy-, 1-carboxyethyl ester are: (1)ACD/LogP: -0.43; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.27; (4)ACD/LogD (pH 7.4): -4.14; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Index of Refraction: 1.47; (13)Molar Refractivity: 34.63 cm³; (14)Molar Volume: 123.9 cm³; (15)Surface Tension: 49.5 dyne/cm; (16)Density: 1.308 g/cm³; (17)Flash Point: 132.4 °C; (18)Enthalpy of Vaporization: 64.51 kJ/mol; (19)Boiling Point: 315.2 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OC(C(=O)O)C)C(O)C
(2)InChI: InChI=1/C6H10O5/c1-3(7)6(10)11-4(2)5(8)9/h3-4,7H,1-2H3,(H,8,9)
(3)InChIKey: OZZQHCBFUVFZGT-UHFFFAOYAS