The Thymidine, 5,6-dihydro-, with the CAS registry number 5627-00-9, is also known as 5,6-Dihydrothymidine. This chemical's molecular formula is C₁₀H₁₆N₂O₅ and molecular weight is 244.24. What's more, its systematic name is 1-methyl-3-phenyl-1H-pyrazol-5-amine. Its storage temperature is −20°C.

Physical properties of Thymidine, 5,6-dihydro- are: (1)ACD/LogP: -1.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.95; (4)ACD/LogD (pH 7.4): -1.95; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 2.07; (8)ACD/KOC (pH 7.4): 2.07; (9)#H bond acceptors: 7; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 68.31 Å²; (13)Index of Refraction: 1.553; (14)Molar Refractivity: 56.24 cm³; (15)Molar Volume: 175.5 cm³; (16)Polarizability: 22.29×10^-24 cm³; (17)Surface Tension: 57.1 dyne/cm; (18)Density: 1.391 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: O=C1N(CC(C(=O)N1)C)[C@@H]2O[C@@H]([C@@H](O)C2)CO
(2)InChI: InChI=1/C10H16N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h5-8,13-14H,2-4H2,1H3,(H,11,15,16)/t5?,6-,7+,8+/m0/s1
(3)InChIKey: FEYHMSUYKIMUAL-UNYLCCJPBX