Products Categories
CAS No.: | 444912-75-8 |
---|---|
Name: | AM-2233 |
Article Data: | 1 |
Molecular Structure: | |
Formula: | C22H23IN2O |
Molecular Weight: | 458.342 |
Synonyms: | (2-Iodophenyl)[1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl]methanone; 1-[(N-Methyl-2-piperidinyl)methyl]-3-(2-iodobenzoyl)-1H-indole;(2-Iodophenyl){1-[(1-methylpiperidin-2-yl)methyl]-1H-indol-3-yl}methanone;1-[(N-Methylpiperidin-2-yl)methyl]-3-(2-iodobenzoyl)indole;Methanone, (2-iodophenyl)[1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl]-;AM2233; |
EINECS: | 806-351-3 |
Density: | 1.487 g/cm3 |
Boiling Point: | 571.01 °C at 760 mmHg |
Flash Point: | 299.136 °C |
PSA: | 25.24000 |
LogP: | 4.89910 |
The AM-2233 with CAS registry number of 444912-75-8 is also known as 1-[(N-Methylpiperidin-2-yl)methyl]-3-(2-iodobenzoyl)indole. The systematic name is (2-Iodophenyl){1-[(1-methylpiperidin-2-yl)methyl]-1H-indol-3-yl}methanone. In addition, the formula is C22H23IN2O and the molecular weight is 458.34. What's more, it is a drug which acts as a highly potent full agonist for the cannabinoid receptors.
Physical properties about AM-2233 are: (1)ACD/LogP: 6.44; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 4; (6)ACD/BCF (pH 7.4): 34; (7)ACD/KOC (pH 5.5): 12; (8)ACD/KOC (pH 7.4): 113; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Index of Refraction: 1.669; (13)Molar Refractivity: 114.973 cm3; (14)Molar Volume: 308.199 cm3; (15)Surface Tension: 48.593 dyne/cm; (16)Density: 1.487 g/cm3; (17)Flash Point: 299.136 °C; (18)Enthalpy of Vaporization: 85.631 kJ/mol; (19)Boiling Point: 571.01 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
1. SMILES:Ic1ccccc1C(=O)c2c4ccccc4n(c2)CC3N(C)CCCC3
2. Std. InChI:InChI=1S/C22H23IN2O/c1-24-13-7-6-8-16(24)14-25-15-19(17-9-3-5-12-21(17)25)22(26)18-10-2-4-11-20(18)23/h2-5,9-12,15-16H,6-8,13-14H2,1H3
3. Std. InChIKey:KSLCYQTUSSEGPT-UHFFFAOYSA-N