110888-15-8 Usage
Description
4-Chloro-3-fluorobenzonitrile is an organic compound that serves as a crucial intermediate in the synthesis of various fluorinated aromatic compounds. It is characterized by its off-white powdery appearance and plays a significant role in the chemical industry due to its versatile reactivity and potential applications.
Uses
Used in Pharmaceutical Industry:
4-Chloro-3-fluorobenzonitrile is used as a key intermediate for the synthesis of 3,4-Difluorobenzonitrile, which is an essential building block in the development of various pharmaceutical compounds. Its unique structure allows for the creation of novel molecules with potential therapeutic applications, contributing to the advancement of drug discovery and development.
Used in Chemical Synthesis:
In the chemical synthesis industry, 4-Chloro-3-fluorobenzonitrile is utilized to prepare other fluorobenzonitriles. These fluorinated derivatives find applications in various fields, including agrochemicals, materials science, and specialty chemicals, due to their unique properties and reactivity.
Used in Research and Development:
4-Chloro-3-fluorobenzonitrile is also employed in research and development settings, where it is used to explore new synthetic pathways and develop innovative chemical processes. Its unique structural features make it an attractive candidate for the design and synthesis of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 110888-15-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,8,8 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 110888-15:
(8*1)+(7*1)+(6*0)+(5*8)+(4*8)+(3*8)+(2*1)+(1*5)=118
118 % 10 = 8
So 110888-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H
110888-15-8Relevant articles and documents
Continuous production method for industrially preparing 2,3-difluorobenzotrifluoride and 3,4-difluorobenzonitrile
-
Paragraph 0032, (2018/03/24)
The invention discloses a continuous production method for industrially preparing 2,3-difluorobenzotrifluoride and 3,4-difluorobenzonitrile. The preparation process of the 2,3-difluorobenzotrifluoride comprises the preparation step of an intermediate raw material for benzene sulfonamide and benzenesulfonylurea herbicides, and the preparation process of the 3,4-difluorobenzonitrile comprises the preparation step of a cthalofop-butyl intermediate raw material. The method is suitable for industrial production; and compared with the prior art, the method has the advantages of low cost, high production method and less pollution.