1780-48-9 Usage
Description
2-BENZOYLVALERONITRILE, also known as diethyl (2-cyano-2-phenylacetyl)malonate, is a chemical compound that serves as a versatile intermediate and building block in organic synthesis and pharmaceutical research. It is recognized for its unique chemical properties, making it a key starting material for the production of various drugs and other bioactive molecules. Its significance in the pharmaceutical and chemical industries is underscored by its role in drug discovery and development, as well as its potential for further research and innovation.
Uses
Used in Pharmaceutical Research and Development:
2-BENZOYLVALERONITRILE is used as a key intermediate for the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and bioactive molecules. Its unique chemical properties make it an essential component in the creation of novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 2-BENZOYLVALERONITRILE is utilized as a building block for the construction of complex organic molecules. Its versatility allows for its incorporation into a wide range of chemical structures, facilitating the advancement of chemical research and the synthesis of new compounds.
Used in Drug Discovery:
2-BENZOYLVALERONITRILE is employed as a starting material in drug discovery, where its unique properties are leveraged to explore its potential applications in the development of new therapeutic agents. Research studies on this compound are ongoing, aiming to uncover its full potential in the pharmaceutical industry.
Used in Chemical Industry:
2-BENZOYLVALERONITRILE plays a significant role in the chemical industry, where it is used in the production of various chemical products. Its versatility and unique properties make it a valuable asset in the synthesis of a range of chemical compounds, contributing to the growth and innovation within the industry.
Check Digit Verification of cas no
The CAS Registry Mumber 1780-48-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,8 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1780-48:
(6*1)+(5*7)+(4*8)+(3*0)+(2*4)+(1*8)=89
89 % 10 = 9
So 1780-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO/c1-2-6-11(9-13)12(14)10-7-4-3-5-8-10/h3-5,7-8,11H,2,6H2,1H3
1780-48-9Relevant articles and documents
Sustainable Palladium-Catalyzed Tsuji-Trost Reactions Enabled by Aqueous Micellar Catalysis
Braga, Felipe C.,Gallou, Fabrice,Lee, Nicholas R.,Lippincott, Daniel J.,Lipshutz, Bruce H.,Moghadam, Farbod A.,Zhu, Bingchun
supporting information, (2020/07/15)
Palladium-catalyzed allylic substitution, or "Tsuji-Trost"reactions, can be run under micellar catalysis conditions featuring not only chemistry in water but also numerous combinations of reaction partners that require low levels of palladium, typically on the order of 1000 ppm (0.1 mol %). These couplings are further characterized by especially mild conditions, leading to a number of cases not previously reported in an aqueous micellar medium. Inclusion of diverse nucleophiles, such as N-H heterocycles, alcohols, dicarbonyl compounds, and sulfonamides is described. Intramolecular cyclizations further illustrate the broad utility of this process. In addition to recycling studies, a multigram scale example is reported, indicative of the prospects for scale up.
