104314-01-4 Usage
Description
(2Z)-3-(4-Methoxyphenyl)-2-thien-2-ylacrylic acid, also known as 3-(4-methoxyphenyl)-2-thiophen-2-ylacrylic acid, is a chemical compound with a molecular formula of C12H10O3S. It is a derivative of thienylacrylic acid and contains a thienyl group, a phenyl group, and a methoxy group. (2Z)-3-(4-METHOXYPHENYL)-2-THIEN-2-YLACRYLIC ACID is commonly used in organic synthesis and medicinal chemistry research.
Uses
Used in Organic Synthesis:
(2Z)-3-(4-METHOXYPHENYL)-2-THIEN-2-YLACRYLIC ACID is used as a building block for the synthesis of various organic materials. Its unique structure allows it to be a versatile component in the creation of new compounds with potential applications in various industries.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (2Z)-3-(4-METHOXYPHENYL)-2-THIEN-2-YLACRYLIC ACID is used as a starting material for the development of pharmaceuticals. Its properties and potential applications are still being explored, but it has shown promising potential in the synthesis of new drugs and therapeutic agents.
Used in Pharmaceutical Synthesis:
(2Z)-3-(4-METHOXYPHENYL)-2-THIEN-2-YLACRYLIC ACID is used as a key intermediate in the synthesis of pharmaceuticals. Its unique chemical structure contributes to the development of new drugs with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 104314-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,3,1 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 104314-01:
(8*1)+(7*0)+(6*4)+(5*3)+(4*1)+(3*4)+(2*0)+(1*1)=64
64 % 10 = 4
So 104314-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H12O3S/c1-17-11-6-4-10(5-7-11)9-12(14(15)16)13-3-2-8-18-13/h2-9H,1H3,(H,15,16)/p-1/b12-9+
