114499-45-5 Usage
General Description
3 7-DIMETHYLOCTYLMAGNESIUM BROMIDE 1.0 is a chemical compound that consists of a magnesium atom bonded to an octyl group and two methyl groups, with a bromide ion attached. It is commonly used as a reagent in organic synthesis, particularly in the formation of carbon-carbon bonds. 3 7-DIMETHYLOCTYLMAGNESIUM BROMIDE 1.0& is known for its high reactivity and selectivity in various organic reactions, making it a valuable tool for chemists in the development of new molecules and compounds. It is often used as a catalyst or a source of magnesium in Grignard reactions, which are important processes in the production of pharmaceuticals, agrochemicals, and fine chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 114499-45-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,4,9 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 114499-45:
(8*1)+(7*1)+(6*4)+(5*4)+(4*9)+(3*9)+(2*4)+(1*5)=135
135 % 10 = 5
So 114499-45-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H21.BrH.Mg/c1-5-10(4)8-6-7-9(2)3;;/h9-10H,1,5-8H2,2-4H3;1H;/q-1;;+2/p-1
114499-45-5Relevant articles and documents
NEAR-INFRARED ABSORPTION COMPOSITION, CURED FILM, NEAR-INFRARED CUT FILTER, SOLID-STATE IMAGING DEVICE, INFRARED SENSOR, AND COMPOUND
-
Paragraph 0339; 0350, (2018/01/04)
To provide a near-infrared absorption composition which contains a squarylium compound having excellent solvent solubility, a cured film which uses the near-infrared absorption composition, a near-infrared cut filter, a solid-state imaging device, an infrared sensor, and a compound. A near-infrared absorption composition includes a compound represented by the following Formula (1) and a resin. R1 and R2 each independently represent “—S1-L1-T1” or the like, R3 and R4 each independently represent a hydrogen atom or an alkyl group, X1 and X2 each independently represent an oxygen atom or —N(R5)—, R5 represents a hydrogen atom or the like, Y1 to Y4 each independently represent a substituent, p and s each independently represent an integer of 0 to 3, and q and r each independently represent an integer of 0 to 2; and S1 represents an arylene group or the like, L1 represents an alkylene group or the like, and T1 represents an alkyl group or the like.