129423-29-6 Usage
Description
TRANS-3-PHENYL-1-PROPEN-1-YLBORONIC ACID is an organic compound that serves as a versatile reagent in various chemical reactions and synthesis processes. It is characterized by its unique structure, which includes a phenyl group and a boronic acid functional group, making it a valuable intermediate in the preparation of complex organic molecules.
Uses
Used in Pharmaceutical Industry:
TRANS-3-PHENYL-1-PROPEN-1-YLBORONIC ACID is used as a key reactant for the synthesis of various pharmaceutical compounds. Its ability to participate in multiple types of chemical reactions, such as carbonylative arylation, oxidative cross-coupling, and Suzuki-Miyaura coupling, makes it a valuable tool in the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
In the field of chemical synthesis, TRANS-3-PHENYL-1-PROPEN-1-YLBORONIC ACID is used as a building block for the creation of complex organic molecules. Its reactivity in various coupling reactions, such as three-component reductive coupling with alkynes, allows for the efficient construction of diverse molecular structures with potential applications in various industries.
Used in Enantioselective Synthesis:
TRANS-3-PHENYL-1-PROPEN-1-YLBORONIC ACID is also utilized in enantioselective conjugation to vinyl 2-pyridylsulfones, a process that is crucial for the development of chiral compounds with specific biological activities. This application is particularly relevant in the pharmaceutical industry, where the enantiomeric purity of a drug can significantly impact its efficacy and safety.
Overall, TRANS-3-PHENYL-1-PROPEN-1-YLBORONIC ACID is a versatile and valuable compound in the fields of pharmaceuticals, chemical synthesis, and enantioselective chemistry, playing a crucial role in the development of new drugs, materials, and other advanced applications.
Check Digit Verification of cas no
The CAS Registry Mumber 129423-29-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,4,2 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 129423-29:
(8*1)+(7*2)+(6*9)+(5*4)+(4*2)+(3*3)+(2*2)+(1*9)=126
126 % 10 = 6
So 129423-29-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BO2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-6,8,11-12H,7H2/b8-4+
129423-29-6Relevant articles and documents
A Tunable Route to Prepare α,β-Unsaturated Esters and α,β-Unsaturated-γ-Keto Esters through Copper-Catalyzed Coupling of Alkenyl Boronic Acids with Phosphorus Ylides
Bi, Hong-Yan,Liu, Feng-Ping,Liang, Cui,Su, Gui-Fa,Mo, Dong-Liang
supporting information, p. 1510 - 1516 (2018/03/05)
A tunable strategy to prepare α,β-unsaturated esters and α,β-unsaturated-γ-keto esters in good to excellent yields was developed through copper-catalyzed oxidative coupling of phosphorus ylides with alkenyl boronic acids under mild conditions. The reaction without water afforded α,β-unsaturated esters, ketones, and amides while α,β-unsaturated-γ-keto esters, 1,4-α,β-unsaturated diketones and α,β-unsaturated-γ-keto amides were obtained when using 5.0 equiv. of water. H2O18 labeling experiments showed that water played an important role in the formation of α,β-unsaturated-γ-keto esters. A plausible formation mechanism for α,β-unsaturated esters and α,β-unsaturated-γ-keto esters was proposed based on mechanistic studies. Phosphonium salts could also be used directly as coupling partners instead of phosphorus ylides. The reaction exhibited a broad substrate scope, good functional group tolerance, good regioselectivity, and diverse coupling products. (Figure presented.).
Rhodium(III)-catalyzed cross-coupling of alkenylboronic acids and N -pivaloyloxylamides
Feng, Chao,Loh, Teck-Peng
supporting information, p. 3444 - 3447 (2014/07/21)
Rh(III)-catalyzed umpolung amidation of alkenylboronic acids for the synthesis of enamides is reported. This reaction proceeds readily at room temperature and displays an extremely wide spectrum of functional group tolerance. With cooperation of hydrobora
