1470-04-8 Usage
Description
5,6,8,9-TETRAHYDROBENZ[A]ANTHRACEN-11(10H)-ONE is a chemical compound that serves as an intermediate in the synthesis of various compounds. It is characterized by its unique molecular structure and properties, making it a valuable component in chemical reactions and processes.
Uses
Used in Chemical Synthesis:
5,6,8,9-TETRAHYDROBENZ[A]ANTHRACEN-11(10H)-ONE is used as an intermediate in the synthesis of Benz[l]aceanthrylene (B183405), which is a mutagenic agent. Its role in this process is crucial for the production of the final product, highlighting its importance in the chemical industry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5,6,8,9-TETRAHYDROBENZ[A]ANTHRACEN-11(10H)-ONE is used as a key component in the development of new drugs and therapies. Its unique properties and reactivity make it a valuable asset in the creation of novel compounds with potential medicinal applications.
Used in Research and Development:
5,6,8,9-TETRAHYDROBENZ[A]ANTHRACEN-11(10H)-ONE is also utilized in research and development settings, where it is employed to study its chemical properties and potential applications in various fields. This includes exploring its use in the synthesis of new materials, its interaction with other compounds, and its potential as a building block for more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 1470-04-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,7 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1470-04:
(6*1)+(5*4)+(4*7)+(3*0)+(2*0)+(1*4)=58
58 % 10 = 8
So 1470-04-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O/c19-18-7-3-5-13-10-14-9-8-12-4-1-2-6-15(12)16(14)11-17(13)18/h1-2,4,6,10-11H,3,5,7-9H2