170981-26-7 Usage
Description
2-Fluoro-4-methylphenylboronic acid, with the CAS number 170981-26-7, is an off-white crystalline powder that serves as a valuable compound in organic synthesis. It is characterized by the presence of a fluorine atom at the 2nd position and a methyl group at the 4th position on a phenyl ring, which is connected to a boronic acid group. This unique structure endows it with specific reactivity and properties that make it suitable for various applications in chemical synthesis.
Uses
Used in Pharmaceutical Industry:
2-Fluoro-4-methylphenylboronic acid is used as a reactant for the water-accelerated Pd-catalyzed Suzuki-Miyaura coupling, a widely employed method in the synthesis of pharmaceutical compounds. This reaction allows for the formation of carbon-carbon bonds, which are crucial for constructing complex organic molecules, including those with potential therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Fluoro-4-methylphenylboronic acid is used as a building block for the creation of various organic compounds. Its unique structure allows it to participate in a range of reactions, such as the Suzuki reaction, which is a type of cross-coupling reaction that forms carbon-carbon bonds. This makes it a versatile component in the synthesis of a wide array of organic molecules, including those with potential applications in materials science, agrochemicals, and other industries.
Used in Research and Development:
2-Fluoro-4-methylphenylboronic acid is also utilized in research and development settings, where it can be employed to study the effects of fluorination and methylation on the reactivity and properties of organic compounds. This can lead to the discovery of new synthetic routes, novel compounds, and a deeper understanding of the underlying chemical principles.
Check Digit Verification of cas no
The CAS Registry Mumber 170981-26-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,9,8 and 1 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 170981-26:
(8*1)+(7*7)+(6*0)+(5*9)+(4*8)+(3*1)+(2*2)+(1*6)=147
147 % 10 = 7
So 170981-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BFO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3
170981-26-7Relevant articles and documents
AZA-BICYCLOALKYL ETHERS AND THEIR USE AS ALPHA7-NACHR AGONIST
-
Page 23, (2008/06/13)
The present invention relates to 1-aza-bicycloalkyl derivatives of formula (I), wherein X is CH2 or a single bond; Y is a group of formula (II, III, IV) and wherein R has the meanings as defined in the specification, which compounds are alpha 7 nicotinic
Branched alkoxy-substituted 2-aminopyridines as NOS inhibitors
-
Example 2, (2008/06/13)
The present invention relates to 6-phenyl-pyridin-2-ylamine derivatives of the formula wherein R1, R2, R3and R4are defined as in the specification, that exhibit activity as nitric oxide synthase (NOS) inhibitors