5473-05-2 Usage
Description
4,6-Diamino-5-benzeneazo-2-methylpyrimidine, with the CAS number 5473-05-2, is an organic compound that is widely utilized in the field of organic synthesis. It is a heterocyclic compound characterized by the presence of both amino and azo groups, which contribute to its chemical reactivity and potential applications in various industries.
Uses
Used in Organic Synthesis:
4,6-Diamino-5-benzeneazo-2-methylpyrimidine is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows it to be a versatile building block for the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4,6-Diamino-5-benzeneazo-2-methylpyrimidine is used as a starting material for the development of new drugs. Its chemical properties make it a valuable component in the design and synthesis of novel therapeutic agents, particularly those targeting specific biological pathways or receptors.
Used in Dye Manufacturing:
4,6-Diamino-5-benzeneazo-2-methylpyrimidine is also used in the manufacturing of dyes due to its azo group, which is known for its ability to produce a wide range of colors. 4,6-DIAMINO-5-BENZENEAZO-2-METHYLPYRIMIDINE can be utilized in the production of various types of dyes for different applications, such as textiles, plastics, and printing inks.
Used in Chemical Research:
In the field of chemical research, 4,6-Diamino-5-benzeneazo-2-methylpyrimidine serves as a valuable compound for studying various chemical reactions and mechanisms. Its unique structure allows researchers to explore new reaction pathways and develop innovative synthetic strategies, contributing to the advancement of chemical science.
Check Digit Verification of cas no
The CAS Registry Mumber 5473-05-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,7 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5473-05:
(6*5)+(5*4)+(4*7)+(3*3)+(2*0)+(1*5)=92
92 % 10 = 2
So 5473-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N6/c1-7-14-10(12)9(11(13)15-7)17-16-8-5-3-2-4-6-8/h2-6H,1H3,(H4,12,13,14,15)/b17-16+
