63019-59-0 Usage
Chemical compound
A synthetic substance used in various applications due to its unique properties.
Fluorescence probe
It is commonly used as a fluorescence probe, indicating its ability to emit light when exposed to a specific wavelength.
High fluorescence quantum yield
This property means that the compound is highly efficient in converting absorbed light into emitted light, making it a valuable tool in research and diagnostics.
Large Stokes shift
The difference between the excitation and emission wavelengths is significant, which is beneficial for reducing the overlap of excitation and emission spectra, leading to better signal separation and improved detection.
p-(dimethylamino)styryl substituent
A functional group attached to the benz[a]acridine core, responsible for the compound's strong fluorescence properties.
Fluorophore
A molecule that can absorb light and re-emit it at a longer wavelength, making it useful for various biological and analytical applications.
Research applications
It has been used in DNA sequencing, single-molecule imaging, and protein labeling, showcasing its versatility in scientific research.
Strong fluorescence properties
The compound's high fluorescence efficiency makes it an attractive candidate for various applications, including imaging and diagnostics.
Potential use in medical imaging and diagnostics
Due to its unique optical properties, it can be used as a contrast agent to improve the visualization of biological structures and processes.
Contrast agent
A substance that enhances the visibility of specific structures or processes in medical imaging, aiding in the detection and diagnosis of various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 63019-59-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,1 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63019-59:
(7*6)+(6*3)+(5*0)+(4*1)+(3*9)+(2*5)+(1*9)=110
110 % 10 = 0
So 63019-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C27H22N2/c1-29(2)21-15-11-19(12-16-21)13-17-24-23-9-5-6-10-25(23)28-26-18-14-20-7-3-4-8-22(20)27(24)26/h3-18H,1-2H3/b17-13-