72943-43-2 Usage
General Description
2-AMINO-5-IODO-6-PHENYL-4(1H)-PYRIMIDINONE is a chemical compound that belongs to the class of pyrimidinones. It consists of a pyrimidine ring with an amino group at position 2, an iodo group at position 5, and a phenyl group at position 6. 2-AMINO-5-IODO-6-PHENYL-4(1H)-PYRIMIDINONE has potential applications in pharmaceutical and medicinal chemistry due to its structural features and potential biological activities. It can be used as a building block in the synthesis of new pharmaceutical compounds or as a precursor in the development of drugs targeting specific biological pathways. Additionally, it may also have other industrial applications in the field of agrochemicals or materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 72943-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,9,4 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 72943-43:
(7*7)+(6*2)+(5*9)+(4*4)+(3*3)+(2*4)+(1*3)=142
142 % 10 = 2
So 72943-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8IN3O/c11-7-8(6-4-2-1-3-5-6)13-10(12)14-9(7)15/h1-5H,(H3,12,13,14,15)
