91421-87-3 Usage
Description
ATRIAL NATRIURETIC PEPTIDE (126-149) (RAT) is a peptide hormone derived from the larger atrial natriuretic peptide (ANP), produced by the heart. It plays a crucial role in regulating blood pressure and fluid balance in the body, exhibiting potent natriuretic, diuretic, and vasorelaxant effects.
Used in Pharmaceutical Industry:
ATRIAL NATRIURETIC PEPTIDE (126-149) (RAT) is used as a therapeutic agent for the treatment of conditions such as hypertension and heart failure. Its application is based on its ability to act on the kidneys, promoting the excretion of sodium and water, leading to a decrease in blood volume and ultimately a reduction in blood pressure. Additionally, it is implicated in the regulation of cardiac function, making it a potential candidate for the treatment of heart-related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 91421-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,4,2 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 91421-87:
(7*9)+(6*1)+(5*4)+(4*2)+(3*1)+(2*8)+(1*7)=123
123 % 10 = 3
So 91421-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C104H168N38O33S2/c1-8-51(5)80-98(172)124-41-75(150)125-53(7)82(156)129-59(28-29-72(106)147)87(161)137-66(44-143)86(160)123-42-77(152)127-61(34-50(3)4)84(158)122-43-78(153)128-70(96(170)134-64(37-73(107)148)91(165)138-68(46-145)93(167)133-63(36-55-22-14-11-15-23-55)90(164)131-60(100(174)175)27-19-33-119-104(114)115)48-176-177-49-71(140-95(169)69(47-146)139-94(168)67(45-144)136-83(157)56(105)24-16-30-116-101(108)109)97(171)132-62(35-54-20-12-10-13-21-54)85(159)121-39-74(149)120-40-76(151)126-57(25-17-31-117-102(110)111)88(162)142-81(52(6)9-2)99(173)135-65(38-79(154)155)92(166)130-58(89(163)141-80)26-18-32-118-103(112)113/h10-15,20-23,50-53,56-71,80-81,143-146H,8-9,16-19,24-49,105H2,1-7H3,(H2,106,147)(H2,107,148)(H,120,149)(H,121,159)(H,122,158)(H,123,160)(H,124,172)(H,125,150)(H,126,151)(H,127,152)(H,128,153)(H,129,156)(H,130,166)(H,131,164)(H,132,171)(H,133,167)(H,134,170)(H,135,173)(H,136,157)(H,137,161)(H,138,165)(H,139,168)(H,140,169)(H,141,163)(H,142,162)(H,154,155)(H,174,175)(H4,108,109,116)(H4,11