92899-39-3 Usage
General Description
H-VAL-GLY-VAL-ALA-PRO-GLY-OH is a peptide composed of the amino acids valine, glycine, alanine, proline, and glycine, connected in that specific order. These amino acids are organic compounds that are essential for the proper functioning and structure of proteins. Valine is an essential amino acid that plays a role in muscle metabolism and energy production. Glycine is a non-essential amino acid that is involved in the synthesis of important compounds in the body, such as heme and creatine. Alanine is another non-essential amino acid that plays a role in the production of glucose during periods of fasting or intense exercise. Proline is a unique amino acid that helps maintain the structure of proteins, while glycine serves as a building block for proteins. Together, these amino acids contribute to the biological functions and properties of the peptide H-VAL-GLY-VAL-ALA-PRO-GLY-OH.
Check Digit Verification of cas no
The CAS Registry Mumber 92899-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,8,9 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 92899-39:
(7*9)+(6*2)+(5*8)+(4*9)+(3*9)+(2*3)+(1*9)=193
193 % 10 = 3
So 92899-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H38N6O7/c1-11(2)17(23)20(33)24-9-15(29)27-18(12(3)4)21(34)26-13(5)22(35)28-8-6-7-14(28)19(32)25-10-16(30)31/h11-14,17-18H,6-10,23H2,1-5H3,(H,24,33)(H,25,32)(H,26,34)(H,27,29)(H,30,31)/t13-,14-,17-,18-/m0/s1