103204-69-9 Usage
Uses
Used in Organic Synthesis:
4-Acetamido-2-methylbenzoic acid is used as a key intermediate in the synthesis of various complex organic compounds. Its reactivity from both the carboxylic acid and amide functional groups allows it to participate in a range of reactions, facilitating the creation of an array of organic substances.
Used in Scientific Research:
As a laboratory reagent, 4-Acetamido-2-methylbenzoic acid is utilized in scientific research for its ability to participate in various chemical reactions. It aids in the development and understanding of new organic compounds and their potential applications.
Used in Pharmaceutical Industry:
4-Acetamido-2-methylbenzoic acid is used as a building block in the pharmaceutical industry for the development of new drugs. Its unique structure and reactivity make it a valuable component in the synthesis of medicinal compounds.
Used in Chemical Manufacturing:
In the chemical manufacturing industry, 4-Acetamido-2-methylbenzoic acid is used as a raw material for the production of various chemical products. Its versatility in organic synthesis contributes to the development of new and innovative chemical compounds.
Safety Precautions:
Check Digit Verification of cas no
The CAS Registry Mumber 103204-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,0 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 103204-69:
(8*1)+(7*0)+(6*3)+(5*2)+(4*0)+(3*4)+(2*6)+(1*9)=69
69 % 10 = 9
So 103204-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO3/c1-6-5-8(11-7(2)12)3-4-9(6)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14)