104195-79-1 Usage
Uses
Used in Pharmaceutical Industry:
(2R,3R)-2-Amino-3-methyloxybutanoic acid is used as a key intermediate in the synthesis of various drugs for its unique chiral properties and reactivity. It plays a crucial role in the development of new pharmaceuticals with improved efficacy and selectivity.
Used in Organic Chemistry Research:
(2R,3R)-2-Amino-3-methyloxybutanoic acid is used as a chiral building block in organic chemistry for the synthesis of enantioselective compounds. Its unique structure allows for the creation of novel molecules with potential applications in various fields.
Used in Biochemistry and Medicinal Chemistry:
(2R,3R)-2-Amino-3-methyloxybutanoic acid is used as a chiral molecule in biochemistry and medicinal chemistry research to study its interactions with biological systems and its potential as a therapeutic agent. Its unique properties make it a valuable tool for understanding the role of chirality in biological processes and drug development.
Used in Natural Products:
(2R,3R)-2-Amino-3-methyloxybutanoic acid is found in some natural products, where it may contribute to their biological activities. Researchers are interested in understanding its role in these natural compounds and potentially harnessing its properties for the development of new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 104195-79-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,1,9 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 104195-79:
(8*1)+(7*0)+(6*4)+(5*1)+(4*9)+(3*5)+(2*7)+(1*9)=111
111 % 10 = 1
So 104195-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H11NO3/c1-3(9-2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t3-,4-/m1/s1
