110127-07-6 Usage
Uses
Used in Pharmaceutical Synthesis:
2,6-Dibromo-4-nitrotoluene is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and reactivity allow for the creation of a wide range of medicinal compounds, contributing to the development of new drugs and therapies.
Used in Dye Production:
In the dye industry, 2,6-Dibromo-4-nitrotoluene serves as a crucial component in the production of dyes. Its chemical properties facilitate the creation of dyes with specific color characteristics and stability, making it an essential ingredient in the formulation of various dye products.
Used in Organic Chemistry Research:
As a reactive nitroaromatic compound, 2,6-Dibromo-4-nitrotoluene is utilized in organic chemistry research for studying reaction mechanisms and exploring new synthetic pathways. Its presence in experiments can lead to the discovery of novel chemical reactions and the development of innovative organic compounds.
Used in Chemical Education:
2,6-Dibromo-4-nitrotoluene can be employed as a teaching aid in chemical education to demonstrate the properties and reactions of nitroaromatic compounds. Its use in laboratory settings helps students understand the principles of organic chemistry and the behavior of functional groups in different chemical contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 110127-07-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,1,2 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 110127-07:
(8*1)+(7*1)+(6*0)+(5*1)+(4*2)+(3*7)+(2*0)+(1*7)=56
56 % 10 = 6
So 110127-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3
110127-07-6Relevant articles and documents
Substituted benzonitriles
-
, (2008/06/13)
An improved process for the preparation of 6-substituted-5-alkyl-2,4-quinazolinediamines, useful in the production of trimetrexate and similar antifolate agents, together with several novel intermediates are disclosed.
