1132610-44-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-(6-quinoxalinyl)is used as a potential pharmaceutical agent for its possible interactions with biological targets. The specific structure of the compound may allow it to modulate various biological pathways or serve as a precursor for the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-(6-quinoxalinyl)may be utilized as a component in the development of new pesticides or herbicides. Its unique structure could provide novel modes of action against pests or unwanted plant species.
Used in Materials Science:
Ethanone, 1-(5-fluoro-6-Methyl-2-pyridinyl)-2-(6-quinoxalinyl)could also find applications in materials science, where its specific structural features might contribute to the creation of new materials with unique properties, such as advanced polymers or composites with tailored characteristics for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1132610-44-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,3,2,6,1 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1132610-44:
(9*1)+(8*1)+(7*3)+(6*2)+(5*6)+(4*1)+(3*0)+(2*4)+(1*4)=96
96 % 10 = 6
So 1132610-44-6 is a valid CAS Registry Number.
InChI:InChI=1S/C16H12FN3O/c1-10-12(17)3-5-14(20-10)16(21)9-11-2-4-13-15(8-11)19-7-6-18-13/h2-8H,9H2,1H3
