116858-79-8 Usage
Uses
Used in Chemical Catalysts:
(N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN is used as a catalyst in the chemical industry for facilitating organic reactions. Its application is particularly valuable in the formation of carbon-carbon and carbon-oxygen bonds, which are essential in creating a variety of chemical products.
Used in Polymer Production:
In the polymer industry, (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN is utilized as a catalyst to enhance the production process of polymers. Its role in facilitating bond formation is crucial for the synthesis of polymers with specific properties and applications.
Used in Pharmaceutical Industry:
(N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN is employed as a catalyst in the pharmaceutical sector, where it aids in the synthesis of complex molecular structures required for various drugs. Its ability to form carbon-carbon and carbon-oxygen bonds is particularly useful in creating novel pharmaceutical compounds.
Used in Agricultural Chemicals:
The agricultural chemical industry also benefits from the use of (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN as a catalyst. It is used in the production of various agricultural chemicals, including pesticides and fertilizers, where its catalytic properties help in the synthesis of active ingredients.
Environmental and Health Considerations:
Given the known toxicity of tributyltin compounds to aquatic organisms and their potential environmental and health concerns, it is essential to handle (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN with care. Proper safety measures and handling protocols should be strictly followed to minimize risks and ensure the safe use of this compound in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 116858-79-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,8,5 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 116858-79:
(8*1)+(7*1)+(6*6)+(5*8)+(4*5)+(3*8)+(2*7)+(1*9)=158
158 % 10 = 8
So 116858-79-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H14NO.3C4H9.Sn/c1-6(2)8(5-9)7(3)4;3*1-3-4-2;/h6-7H,1-4H3;3*1,3-4H2,2H3;/rC19H41NOSn/c1-8-11-14-22(15-12-9-2,16-13-10-3)19(21)20(17(4)5)18(6)7/h17-18H,8-16H2,1-7H3
