1197-17-7 Usage
Uses
Used in Pharmaceutical Industry:
cis-4-aminomethylcyclohexane-1-carboxylic acid is used as an active pharmaceutical ingredient for its potential therapeutic effects. It is valued for its ability to modulate various biological pathways and interact with specific target molecules, making it a promising candidate for the development of new drugs.
Used in Chemical Synthesis:
In the chemical industry, cis-4-aminomethylcyclohexane-1-carboxylic acid is used as a building block or intermediate in the synthesis of more complex molecules. Its unique structure and functional groups allow for further chemical modifications, enabling the creation of a wide range of compounds with diverse applications.
Used in Research and Development:
cis-4-aminomethylcyclohexane-1-carboxylic acid is utilized as a research tool in various scientific studies. It helps researchers understand the structure-activity relationships of different compounds and can be used to develop new methodologies or techniques in organic chemistry.
Used in Hemostasis:
As an antifibrinolytic agent, cis-4-aminomethylcyclohexane-1-carboxylic acid is used to block the lysine binding sites of plasminogen, which plays a crucial role in the fibrinolytic process. This property makes it a valuable component in the development of hemostatic agents for medical applications.
Used in Drug Delivery Systems:
Similar to gallotannin, cis-4-aminomethylcyclohexane-1-carboxylic acid can be incorporated into drug delivery systems to enhance its bioavailability and therapeutic outcomes. By employing various carriers such as organic and metallic nanoparticles, the compound can be effectively delivered to target cells or tissues, improving its overall efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 1197-17-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 7 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1197-17:
(6*1)+(5*1)+(4*9)+(3*7)+(2*1)+(1*7)=77
77 % 10 = 7
So 1197-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-5,9H2,(H,10,11)/t6-,7+
1197-17-7Relevant articles and documents
Method for the production of trans-4-aminomethyl cyclohexane-1-carboxylic acid
-
, (2008/06/13)
Disclosed is a method for producing trans-4-aminomethyl cyclohexane-1-carboxylic acid by heating and isomerizing cis-4-aminoethyl cyclohexane-1-carboxylic acid hydrochloride or a mixture of cis-4-aminomethyl cyclohexane-1-carboxylic acid hydrochloride with trans-4-aminomethyl cyclohexane-1-carboxylic acid hydrochloride in an atmosphere of hydrogen chloride gas and in the absence of a solvent.
