130689-05-3 Usage
Uses
Used in Pharmaceutical Industry:
(Z)-2,3-Dihydro-3-(1,3-benzodioxol-5-ylmethylene)-6-methoxy-4H-1-benzo thiopyran-4-one is used as a potential building block for the development of new pharmaceuticals due to its complex structure and resemblance to bioactive compounds. Its unique molecular arrangement may offer novel therapeutic opportunities and contribute to the advancement of drug discovery.
Used in Agrochemical Industry:
In the agrochemical industry, (Z)-2,3-Dihydro-3-(1,3-benzodioxol-5-ylmethylene)-6-methoxy-4H-1-benzo thiopyran-4-one is used as a potential starting point for the synthesis of new agrochemicals. Its complex molecular structure may provide innovative solutions for pest control, crop protection, and other agricultural applications, pending further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 130689-05-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,6,8 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 130689-05:
(8*1)+(7*3)+(6*0)+(5*6)+(4*8)+(3*9)+(2*0)+(1*5)=123
123 % 10 = 3
So 130689-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O4S/c1-20-13-3-5-17-14(8-13)18(19)12(9-23-17)6-11-2-4-15-16(7-11)22-10-21-15/h2-8H,9-10H2,1H3/b12-6+