195189-45-8 Usage
Uses
Used in Pharmaceutical Industry:
3,5-BIS(4-AMINOPHENOXY)BENZOIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activities. Its ability to form complex structures makes it a valuable component in the development of new drugs.
Used in Dye and Pigment Industry:
3,5-BIS(4-AMINOPHENOXY)BENZOIC ACID is used as a building block in the production of dyes and pigments due to its ability to form complex structures with color properties. This makes it a key component in creating a wide range of colorants for various applications.
Used in Corrosion Inhibition:
3,5-BIS(4-AMINOPHENOXY)BENZOIC ACID has been studied for its potential use in corrosion inhibition. Its chemical properties allow it to form protective layers on metal surfaces, reducing the rate of corrosion and extending the lifespan of materials.
Used in Polymer Chemistry:
3,5-BIS(4-AMINOPHENOXY)BENZOIC ACID is utilized in polymer chemistry for its ability to form complex structures. It can be incorporated into polymers to create new materials with unique properties, such as improved strength, flexibility, or resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 195189-45-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,5,1,8 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 195189-45:
(8*1)+(7*9)+(6*5)+(5*1)+(4*8)+(3*9)+(2*4)+(1*5)=178
178 % 10 = 8
So 195189-45-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H16N2O4/c20-13-1-5-15(6-2-13)24-17-9-12(19(22)23)10-18(11-17)25-16-7-3-14(21)4-8-16/h1-11H,20-21H2,(H,22,23)
195189-45-8Relevant articles and documents
Room-temperature free-radical-induced polymerization of 1,1′-(methylenedi-1,4-phenylene)bismaleimide via a novel diphenylquinoxaline-containing hyperbranched aromatic polyamide
Baek, Jong-Beom,Ferguson, John B.,Tan, Loon-Seng
, p. 4385 - 4396 (2007/10/03)
Two new diphenylquinoxaline-containing AB2 monomers, 2,3-bis(4-aminophenyl)quinoxaline-6-carboxylic acid, 5 and 2,3-bis[4-(4-aminophenoxy)phenyl]quinoxaline-6-carboxylic acid, 9 were prepared and polymerized via the Yamazaki reaction to form th