199664-70-5 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-FLUOROPHENYL)-5-OXOVALERIC ACID is used as a reagent for the preparation of indole derivatives, which act as cell protective agents. These indole derivatives have potential applications in the development of drugs targeting cellular damage and promoting cell survival, contributing to the treatment of various diseases and conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-(2-FLUOROPHENYL)-5-OXOVALERIC ACID serves as a reagent in the catalytic N-nitroso aldol reaction of γ,δ-unsaturated δ-lactones. This reaction is significant for the synthesis of complex molecular structures with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
By organizing the information provided, we can see that 5-(2-FLUOROPHENYL)-5-OXOVALERIC ACID is a versatile compound with applications in both the pharmaceutical industry for the development of cell protective agents and in chemical synthesis for the creation of complex molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 199664-70-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,9,6,6 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 199664-70:
(8*1)+(7*9)+(6*9)+(5*6)+(4*6)+(3*4)+(2*7)+(1*0)=205
205 % 10 = 5
So 199664-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H11FO3/c12-9-5-2-1-4-8(9)10(13)6-3-7-11(14)15/h1-2,4-5H,3,6-7H2,(H,14,15)
199664-70-5Relevant articles and documents
Hypervalent iodine-catalyzed oxylactonization of ketocarboxylic acids to ketolactones
Uyanik, Muhammet,Yasui, Takeshi,Ishihara, Kazuaki
, p. 3848 - 3851 (2009)
The hypervalent iodine-catalyzed oxylactonization of ketocarboxylic acids to ketolactones was achieved in the presence of iodobenzene (10 mol %), p-toluenesulfonic acid monohydrate (20 mol %) and meta-chloroperbenzoic acid as a stoichiometric co-oxidant.