3260-44-4 Usage
Uses
Used in Pharmaceutical Development:
4-Hydroxyphthalazine-1-carboxylic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a promising candidate for the development of new drugs, particularly in the area of medicinal chemistry.
Used in Dye Production:
In the dye industry, 4-Hydroxyphthalazine-1-carboxylic acid is used as a precursor in the production of certain dyes. Its chemical properties allow for the creation of dyes with specific color characteristics and stability, making it valuable in the formulation of various colorants.
Used in Organic Material Synthesis:
4-Hydroxyphthalazine-1-carboxylic acid is used as a building block in the synthesis of organic materials. Its potential reactivity and structural features contribute to the development of new materials with unique properties, such as improved stability or enhanced performance in specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3260-44-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,6 and 0 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3260-44:
(6*3)+(5*2)+(4*6)+(3*0)+(2*4)+(1*4)=64
64 % 10 = 4
So 3260-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O3/c12-8-6-4-2-1-3-5(6)7(9(13)14)10-11-8/h1-4H,(H,11,12)(H,13,14)