34122-01-5 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimido[4,5-c]pyridazin-5(1H)-one (9CI) is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, making it a valuable component in the design and synthesis of novel medicinal agents.
Used in Chemical Research:
In the field of chemical research, Pyrimido[4,5-c]pyridazin-5(1H)-one (9CI) serves as an important intermediate for the synthesis of more complex molecules. Its reactivity and structural features make it a useful tool for exploring new chemical reactions and developing innovative synthetic pathways.
Used in Material Science:
Pyrimido[4,5-c]pyridazin-5(1H)-one (9CI) may also find applications in material science, where its unique properties can be exploited to create new materials with specific characteristics. These materials could have potential uses in various industries, such as electronics, optics, or even in the development of advanced materials for energy storage and conversion.
Check Digit Verification of cas no
The CAS Registry Mumber 34122-01-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,1,2 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 34122-01:
(7*3)+(6*4)+(5*1)+(4*2)+(3*2)+(2*0)+(1*1)=65
65 % 10 = 5
So 34122-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O/c11-6-4-1-2-9-10-5(4)7-3-8-6/h1-3H,(H,7,8,10,11)
34122-01-5Relevant articles and documents
Pyrimidopyridazines. 6. Pyrimidopyridazines and 1,2,4-Triazines from Reactions between 6-Hydrazinopyrimidin-4(3H)-ones and Vicinal Dicarbonyl Reagents
Styles, Virgil L.,Morrison, Robert W.
, p. 346 - 350 (2007/10/02)
Reactions between 6-hydrazinopyrimidin-4(3H)-ones and selected vicinal dicarbonyl reagents have produced novel hydrazonopyrimidines, pyrimidopyridazines, and 1,2,4-triazin-5(2H)-ones.Criteria for the successful cyclizations, unexpected physical/chemical p
