34493-87-3 Usage
Uses
Used in Organic Synthesis:
8-quinolyl acrylate is used as a building block in organic synthesis for the production of various pharmaceuticals, agrochemicals, and functional materials. Its unique structure and reactivity contribute to the development of new chemical entities for different applications.
Used in Pharmaceutical Industry:
8-quinolyl acrylate is used as an intermediate in the synthesis of pharmaceuticals due to its potential biological activities. It has been shown to exhibit antimicrobial and anti-inflammatory properties, making it an interesting molecule for further research and development in the pharmaceutical field.
Used in Agrochemical Industry:
8-quinolyl acrylate is used as a building block in the production of agrochemicals, such as pesticides and herbicides. Its unique structure and reactivity enable the development of new agrochemicals with improved efficacy and selectivity.
Used in Functional Materials:
8-quinolyl acrylate is used as a component in the development of functional materials with specific properties, such as light-sensitive materials, polymers with unique characteristics, or materials with antimicrobial properties. Its reactivity and quinolyl group contribute to the creation of materials with tailored properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 34493-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,4,9 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 34493-87:
(7*3)+(6*4)+(5*4)+(4*9)+(3*3)+(2*8)+(1*7)=133
133 % 10 = 3
So 34493-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NO2/c1-2-11(14)15-10-7-3-5-9-6-4-8-13-12(9)10/h2-8H,1H2
34493-87-3Relevant articles and documents
Preparation process of low-cost and environment-friendly bisphenol S
-
Paragraph 0019; 0034; 0043; 0046; 0055; 0058; 0067, (2021/11/26)
The invention discloses a preparation process of bisphenol S with low cost and environmental protection. When the corrosion-resistant paint is sprayed into the interior of the reaction kettle, N atoms and O atoms of the reinforcing filler can interact with the metal ions to form a chelate. The acid resistance of the reaction kettle is higher, and the preparation cost is further reduced.
