611204-94-5 Usage
Structure
Pyrrolo[2,3-b]pyridine with a 2-thienyl substitution
Contains both pyridine and pyrrole rings, with a thiophene group attached to the 5-position of the pyrrolopyridine core.
3. Heterocyclic compound
A compound containing one or more rings with atoms of different elements, in this case, carbon, nitrogen, and sulfur.
4. Biological activities
Exhibits diverse biological activities, such as anti-cancer and anti-inflammatory properties.
5. Potential applications
Has potential use in pharmaceuticals and agrochemicals due to its various biological activities.
6. Importance in medicinal chemistry
The unique structure and properties make it a promising candidate for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 611204-94-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,1,2,0 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 611204-94:
(8*6)+(7*1)+(6*1)+(5*2)+(4*0)+(3*4)+(2*9)+(1*4)=105
105 % 10 = 5
So 611204-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2S/c1-2-10(14-5-1)9-6-8-3-4-12-11(8)13-7-9/h1-7H,(H,12,13)