6259-40-1 Usage
Uses
Used in Chemical Synthesis Industry:
2-AMINO-6-CHLOROTOLUENE HYDROCHLORIDE is used as a key intermediate for the synthesis of various dyes and pigments, which are essential for coloring textiles, plastics, and other materials. Its presence in these compounds enhances color intensity and stability.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2-AMINO-6-CHLOROTOLUENE HYDROCHLORIDE is utilized as a building block in the development of new drugs. Its chemical structure allows for the creation of diverse medicinal compounds with potential therapeutic applications.
Used in Agrochemical Industry:
2-AMINO-6-CHLOROTOLUENE HYDROCHLORIDE also serves as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its role in these formulations contributes to the effectiveness of these products in controlling pests and weeds in agricultural settings.
Used in Research and Development:
In scientific research, 2-AMINO-6-CHLOROTOLUENE HYDROCHLORIDE is employed as a reagent in various chemical reactions and experiments. Its unique properties make it a valuable tool for exploring new chemical pathways and developing innovative applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6259-40-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,5 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6259-40:
(6*6)+(5*2)+(4*5)+(3*9)+(2*4)+(1*0)=101
101 % 10 = 1
So 6259-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClN.ClH/c1-5-6(8)3-2-4-7(5)9;/h2-4H,9H2,1H3;1H
