74420-00-1 Usage
Uses
Used in Pharmaceutical Industry:
1,7-DIDEAZAADENINE is used as a key intermediate for the synthesis of pyrrolotriazines, which are compounds with potential therapeutic applications. These pyrrolotriazines may exhibit various biological activities, such as anti-cancer, anti-inflammatory, or anti-microbial properties, making them valuable in the development of new drugs.
Used in Chemical Research:
1,7-DIDEAZAADENINE can also be utilized in chemical research as a starting material for the development of novel compounds with specific properties. Its unique structure allows for further functionalization and modification, enabling the creation of new molecules with potential applications in various industries, such as materials science, agriculture, or environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 74420-00-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,2 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 74420-00:
(7*7)+(6*4)+(5*4)+(4*2)+(3*0)+(2*0)+(1*0)=101
101 % 10 = 1
So 74420-00-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H3,8,9,10)
74420-00-1Relevant articles and documents
Concise and Efficient Synthesis of 4-Fluoro-1H-pyrrolo[2,3-b]pyridine
Thibault, Carl,L'Heureux, Alexandre,Bhide, Rajeev S.,Ruel, Rejean
, p. 5023 - 5025 (2007/10/03)
(Equation presented) Two routes describing the preparation of 4-fluoro-1H-pyrrolo[2,3-b]pyridine (4a) from 1H-pyrrolo[2,3-b]pyridine N-oxide (1) are presented. Regioselective fluorination was achieved using either the Balz-Schiemann reaction or lithium-halogen exchange.