885877-41-8 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-1,5-DIMETHYL-1H-1,2,3-TRIAZOLE is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and potential biological activity. It contributes to the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 4-BROMO-1,5-DIMETHYL-1H-1,2,3-TRIAZOLE serves as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation enhances the effectiveness of these products in controlling pests and weeds.
Used in Materials Science:
4-BROMO-1,5-DIMETHYL-1H-1,2,3-TRIAZOLE is utilized in the development of new materials with specific properties, such as improved stability, reactivity, or selectivity. Its unique structure allows for the creation of materials with tailored characteristics for various applications.
Used in Organic Synthesis:
As a reagent in organic synthesis, 4-BROMO-1,5-DIMETHYL-1H-1,2,3-TRIAZOLE plays a crucial role in various chemical reactions. It facilitates the formation of new compounds and contributes to the advancement of organic chemistry.
Used in Medicinal Chemistry and Drug Discovery:
4-BROMO-1,5-DIMETHYL-1H-1,2,3-TRIAZOLE has potential applications in the field of medicinal chemistry and drug discovery. Its unique structure and biological activity make it a promising candidate for the development of new therapeutic agents and the improvement of existing drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 885877-41-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,8,7 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 885877-41:
(8*8)+(7*8)+(6*5)+(5*8)+(4*7)+(3*7)+(2*4)+(1*1)=248
248 % 10 = 8
So 885877-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H6BrN3/c1-3-4(5)6-7-8(3)2/h1-2H3
885877-41-8Relevant articles and documents
NOVEL HERBICIDES
-
Page/Page column 112-113, (2008/06/13)
Compounds of formula I: wherein R1, R2, R3, R4, m, R5, R6, n and Y are as defined in claim 1; or N-oxides, salts and optical isomers thereof. Furthermore, the present invention relates to processes for preparing compounds of formula (I), to herbicidal compositions comprising them and to methods of using them to control plants or to inhibit plant growth.
HERBICIDAL ISOXAZOLINE COMPOUNDS
-
Example I22, (2010/11/28)
Novel compounds of formula (I): wherein R1, R2, R3, R4, m, R5, R6, n and Y are as defined in claim 1; or N-oxides, salts and optical isomers thereof. Furthermore, the present invention relates to processes for preparing compounds of formula (I), to herbicidal compositions comprising them and to methods of using them to control plants or to inhibit plant growth.
