887266-95-7 Usage
Uses
Used in Pharmaceutical Industry:
2-CYANO-6-FLUOROBENZALDEHYDE is used as a key intermediate in the synthesis of various pharmaceuticals, contributing to the development of new drugs and medicines. Its unique chemical structure allows it to be a versatile building block in the creation of a wide range of therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2-CYANO-6-FLUOROBENZALDEHYDE serves as an intermediate in the production of pesticides and other crop protection agents. Its incorporation into these products helps to enhance their effectiveness in protecting crops from pests and diseases.
Used in Organic Synthesis:
2-CYANO-6-FLUOROBENZALDEHYDE is utilized as a reagent in organic synthesis, enabling the formation of a variety of complex organic compounds. Its presence in these reactions can facilitate the synthesis of target molecules with specific properties and applications.
Used in Chemical Reactions:
As a reagent in chemical reactions, 2-CYANO-6-FLUOROBENZALDEHYDE plays a crucial role in various processes, such as oxidation, reduction, and coupling reactions. Its participation in these reactions can lead to the formation of new compounds with diverse applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 887266-95-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,2,6 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 887266-95:
(8*8)+(7*8)+(6*7)+(5*2)+(4*6)+(3*6)+(2*9)+(1*5)=237
237 % 10 = 7
So 887266-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H4FNO/c9-8-3-1-2-6(4-10)7(8)5-11/h1-3,5H
