10305-73-4 Usage
Uses
Used in Pharmaceutical Industry:
(R)-2,3-Dihydro-1H-inden-1-amine hydrochloride is used as a key intermediate in the synthesis of N-[1-(R)-indanyl]adenosine, a drug with potential therapeutic applications. Its role in the production of this drug is crucial, as it contributes to the development of novel treatments for various medical conditions.
Used in Chemical Research:
In addition to its pharmaceutical applications, (R)-2,3-Dihydro-1H-inden-1-amine hydrochloride can also be utilized in chemical research and development. Its unique chemical properties make it a valuable compound for exploring new reactions, syntheses, and potential applications in various fields, including materials science and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 10305-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,0 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10305-73:
(7*1)+(6*0)+(5*3)+(4*0)+(3*5)+(2*7)+(1*3)=54
54 % 10 = 4
So 10305-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N.ClH/c10-9-6-5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H/t9-;/m1./s1