14080-56-9 Usage
Uses
Used in Pharmaceutical Industry:
Thieno[2,3-d]pyrimidin-4-amine is used as a key intermediate in the synthesis of pharmacologically active compounds for its potential in developing new drugs. Its unique structure and reactivity contribute to the creation of novel chemical entities with biological activities, making it valuable in drug discovery and medicinal chemistry.
Used in Drug Development:
As a building block in the synthesis of kinase inhibitors and antineoplastic agents, Thieno[2,3-d]pyrimidin-4-amine plays a crucial role in the development of targeted therapies for various diseases, including cancer. Its presence in these compounds can enhance their efficacy and selectivity, leading to improved treatment options for patients.
Used in Organic Synthesis:
Thieno[2,3-d]pyrimidin-4-amine is utilized as an important intermediate in organic synthesis, enabling the creation of new chemical entities with potential biological activities. Its versatility in forming various chemical entities makes it a valuable component in the development of innovative pharmaceuticals and other bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 14080-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,8 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 14080-56:
(7*1)+(6*4)+(5*0)+(4*8)+(3*0)+(2*5)+(1*6)=79
79 % 10 = 9
So 14080-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3S/c7-5-4-1-2-10-6(4)9-3-8-5/h1-3H,(H2,7,8,9)
