152811-37-5 Usage
General Description
3,5-Bis[3,5-bis(3,5-dimethoxybenzyloxy)benzyloxy]benzyl Bromide is a highly complex and specific chemical compound with a lengthy and intricate molecular structure. It is a bromide derivative of benzyl, and its synthesis likely involves multiple steps and reagents. Due to its detailed structure, it is likely to possess specific chemical properties and potentially have applications in organic synthesis or medicinal chemistry. The compound's properties and potential uses would need to be determined through further research and testing in a laboratory setting.
Check Digit Verification of cas no
The CAS Registry Mumber 152811-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,2,8,1 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 152811-37:
(8*1)+(7*5)+(6*2)+(5*8)+(4*1)+(3*1)+(2*3)+(1*7)=115
115 % 10 = 5
So 152811-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C57H59BrO14/c1-59-44-11-38(12-45(23-44)60-2)31-69-54-19-42(20-55(28-54)70-32-39-13-46(61-3)24-47(14-39)62-4)35-67-52-9-37(30-58)10-53(27-52)68-36-43-21-56(71-33-40-15-48(63-5)25-49(16-40)64-6)29-57(22-43)72-34-41-17-50(65-7)26-51(18-41)66-8/h9-29H,30-36H2,1-8H3
152811-37-5Relevant articles and documents
Dendrimer diarylethenes: The memory effect of conformation in polymer matrices
Fujimoto, Yuhei,Ubukata, Takashi,Yokoyama, Yasushi
supporting information; experimental part, p. 5755 - 5757 (2009/04/13)
Photochromic dendrimer diarylethenes with a C-2-connected bisbenzothienylethene core were synthesized; the most notable feature of them is the strong memory effect of cyclizable conformation of the open form when generated from the closed form by visible