1804-28-0 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(p-methylbenzyl)cyclopropanecarboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its unique cyclopropane ring structure and reactivity. Its presence in the molecular structure of certain drugs can influence their pharmacological properties and therapeutic effects.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(p-methylbenzyl)cyclopropanecarboxylic acid is employed as a starting material or a building block for the development of new drug candidates. Its cyclopropane ring and p-methylbenzyl substituent may contribute to the discovery of novel compounds with improved biological activity and selectivity.
Further study and research are necessary to fully understand the properties and potential uses of 1-(p-methylbenzyl)cyclopropanecarboxylic acid, as its unique structure and reactivity may lead to the development of innovative pharmaceuticals and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1804-28-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,0 and 4 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1804-28:
(6*1)+(5*8)+(4*0)+(3*4)+(2*2)+(1*8)=70
70 % 10 = 0
So 1804-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O2/c1-9-2-4-10(5-3-9)8-12(6-7-12)11(13)14/h2-5H,6-8H2,1H3,(H,13,14)
1804-28-0Relevant articles and documents
Solvent and ligand partition reaction pathways in nickel-mediated carboxylation of methylenecyclopropanes
Murakami, Masahiro,Ishida, Naoki,Miura, Tomoya
, p. 643 - 645 (2008/02/10)
Methylenecyclopropanes are carboxylated with gaseous carbon dioxide in the presence of a stoichiometric amount of a nickel complex; the reaction pathways are significantly influenced by the reaction solvent and the amine ligand. The Royal Society of Chemi
