61-24-5 Usage
Uses
Used in Pharmaceutical Industry:
7-(5-amino-5-carboxyvaleramido)cephalosporanic acid is used as a key intermediate in the synthesis of semi-synthetic cephalosporin antibiotics for the treatment of bacterial infections. Its unique structure allows for the development of antibiotics with improved properties, such as enhanced stability, broader-spectrum activity, and reduced side effects.
Used in Research and Development:
7-(5-amino-5-carboxyvaleramido)cephalosporanic acid is also used in research and development for the discovery and optimization of new cephalosporin antibiotics. Its versatile structure enables the exploration of novel modifications and the investigation of structure-activity relationships, leading to the development of more effective and safer antibiotics.
Used in Drug Synthesis:
In the field of drug synthesis, 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid serves as a crucial building block for the production of various cephalosporin-based drugs. Its presence in the molecular structure allows for the attachment of different side chains, which can modulate the drug's properties and tailor its activity against specific types of bacteria.
Overall, 7-(5-amino-5-carboxyvaleramido)cephalosporanic acid plays a significant role in the pharmaceutical industry, research and development, and drug synthesis, contributing to the advancement of antibiotic therapies and the fight against bacterial infections.
Check Digit Verification of cas no
The CAS Registry Mumber 61-24-5 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 6 and 1 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 61-24:
(4*6)+(3*1)+(2*2)+(1*4)=35
35 % 10 = 5
So 61-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H21N3O8S.Na/c1-7(20)27-5-8-6-28-14-11(13(22)19(14)12(8)16(25)26)18-10(21)4-2-3-9(17)15(23)24;/h9,11,14H,2-6,17H2,1H3,(H,18,21)(H,23,24)(H,25,26);/q;+1/p-1/t9?,11-,14?;/m1./s1