64691-57-2 Usage
Description
Cyclodextrin-benzaldehyde is a chemical compound formed by the union of cyclodextrin, a cyclic oligosaccharide, with benzaldehyde, an organic compound commonly used in fragrances and flavorings. It possesses unique properties such as enhanced solubility, stability, and bioavailability of the encapsulated drug, making it a promising candidate for pharmaceutical applications.
Uses
Used in Pharmaceutical Applications:
Cyclodextrin-benzaldehyde is used as a drug delivery system for improving the delivery and effectiveness of various drugs. Its ability to encapsulate hydrophobic molecules like benzaldehyde allows for better solubility and stability of the encapsulated drug, leading to enhanced bioavailability and therapeutic outcomes.
Used in Fragrance and Flavoring Industry:
Cyclodextrin-benzaldehyde is used as a carrier for benzaldehyde, which is commonly used in fragrances and flavorings. The encapsulation of benzaldehyde by cyclodextrin can improve its stability and release profile, resulting in a more consistent and long-lasting fragrance or flavor.
Check Digit Verification of cas no
The CAS Registry Mumber 64691-57-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,6,9 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 64691-57:
(7*6)+(6*4)+(5*6)+(4*9)+(3*1)+(2*5)+(1*7)=152
152 % 10 = 2
So 64691-57-2 is a valid CAS Registry Number.
InChI:InChI=1/C42H70O35.C7H6O/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51;8-6-7-4-2-1-3-5-7/h8-63H,1-7H2;1-6H/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-;/m1./s1
64691-57-2Relevant articles and documents
Preparation of α-hydroxyphenylacetic acid with cyclodextrins as an effective phase-transfer catalyst and its reaction mechanism
Tian, Bing Ren,Zhang, Rui Xia,Chu, Hui Min,Huang, Qing,Wang, Zhi Zhong
, p. 359 - 368 (2019)
An effective procedure for the synthesis of α-hydroxyphenylacetic acid with cyclodextrin (CD) catalysts was developed. The phase-transfer catalyst types, catalyst loadings, reaction times, reaction temperatures, and substrate molar ratios were investigated to optimize the reaction conditions. In addition, the factors that affect the reaction were studied, and the relationship between benzaldehyde and β-cyclodextrin (β-CD) was analyzed through 2D-ROESY. The equilibrium constant when β-CD was used as the catalyst was calculated. The results indicated that β-CD is the optimal catalyst for the reported reaction (yield: 69.08%). Furthermore, the mechanism underlying the reported reaction was proposed.