76857-14-2 Usage
Uses
Used in Pharmaceutical Industry:
Trisodium 4-carboxy-5-mercapto-3-hydroxy-isothiazole is used as a key intermediate in the synthesis of new cephamycin derivatives. These derivatives are potent antibacterial agents that are effective against a wide range of bacterial infections. Trisodium 4-carboxy-5-mercapto-3-hydroxy-isothiazole plays a crucial role in the development of novel antibiotics to combat drug-resistant bacteria.
Used in Chemical Synthesis:
In addition to its pharmaceutical applications, Trisodium 4-carboxy-5-mercapto-3-hydroxy-isothiazole can also be used as a building block in the synthesis of various other organic compounds. Its unique functional groups, such as the carboxylate and thiol groups, make it a versatile starting material for the preparation of a diverse array of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 76857-14-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,5 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 76857-14:
(7*7)+(6*6)+(5*8)+(4*5)+(3*7)+(2*1)+(1*4)=172
172 % 10 = 2
So 76857-14-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H3NO3S2.3Na/c6-2-1(3(7)8)4(9)10-5-2;;;/h9H,(H,5,6)(H,7,8);;;/q;3*+1
