87540-64-5 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 16 carbon (C), 12 hydrogen (H), 4 nitrogen (N), and 1 sulfur (S) atoms.
2. Heterocyclic compound
Explanation
A heterocyclic compound is a cyclic compound that contains atoms of at least two different elements, in this case, carbon, nitrogen, and sulfur.
3. Contains nitrogen and sulfur atoms
Explanation
The compound's structure includes both nitrogen and sulfur atoms, which contribute to its unique properties and potential applications.
4. Used in pharmaceutical research and development
Explanation
The compound is studied for its potential as a drug candidate, which means it could be developed into a medication for various therapeutic applications.
5. Potential drug candidate
Explanation
The compound's unique structure and properties make it a promising target for drug discovery and design, suggesting it could be developed into a new medication.
6. Further studies and research needed
Explanation
More research is required to fully understand the compound's potential pharmacological activities and therapeutic uses, which will help determine its effectiveness and safety as a drug candidate.
Explanation
This describes the specific arrangement of atoms and functional groups within the compound, which influences its properties and potential applications.
Structure
1,2,4-Triazolo(3,4-a)phthalazine, 6-(ethylthio)-3-phenyl-
Check Digit Verification of cas no
The CAS Registry Mumber 87540-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,5,4 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 87540-64:
(7*8)+(6*7)+(5*5)+(4*4)+(3*0)+(2*6)+(1*4)=155
155 % 10 = 5
So 87540-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N4S/c1-2-22-17-14-11-7-6-10-13(14)16-19-18-15(21(16)20-17)12-8-4-3-5-9-12/h3-11H,2H2,1H3
87540-64-5Relevant articles and documents
6-substituted-s-triazolo[3,4-a]phthalazine derivatives
-
, (2008/06/13)
The present invention refers to new s-triazolo[3,4-a]phthalazine derivatives, to the process for their preparation and to the pharmaceutical compositions containing them.