107888-03-9 Usage
General Description
The chemical "(4E)-4-[[2-[[(E)-(4,5-dioxo-1-phenyl-2-sulfanylidene-pyrrolidin-3-ylidene)-naphthalen-2-yl-methyl]amino]ethylamino]-naphthalen-2-yl-methylidene]-1-phenyl-5-sulfanylidene-pyrrolidine-2,3-dione" is a complex compound with a long name that describes its chemical structure. It is a pyrrolidine derivative containing multiple functional groups, including sulfanyl, amino, and methylidene groups. The compound also contains naphthalene and phenyl moieties. The specific arrangement of these groups in the chemical structure gives "(4E)-4-[[2-[[(E)-(4,5-dioxo-1-phenyl-2-sulfanylidene-pyrrolidin-3-ylidene)-naphthalen-2-yl-methyl]amino]ethylamino]-naphthalen-2-yl-methylidene]-1-phenyl-5-sulfanylidene-pyrrolidine-2,3-dione" its unique properties and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-03-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 107888-03:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*3)=149
149 % 10 = 9
So 107888-03-9 is a valid CAS Registry Number.
InChI:InChI=1/C44H30N4O4S2/c49-39-35(43(53)47(41(39)51)33-15-3-1-4-16-33)37(31-21-19-27-11-7-9-13-29(27)25-31)45-23-24-46-38(32-22-20-28-12-8-10-14-30(28)26-32)36-40(50)42(52)48(44(36)54)34-17-5-2-6-18-34/h1-22,25-26,45-46H,23-24H2/b37-35+,38-36+