107888-04-0 Usage
General Description
The chemical "(4E)-4-[(2-aminoethylamino)-naphthalen-2-yl-methylidene]-1-(4-chlorophenyl)-5-sulfanylidene-pyrrolidine-2,3-dione hydrochloride" is a complex compound with a pyrrolidine-2,3-dione core structure. It contains an aminoethylamino-naphthalen-2-yl-methylidene group, a 4-chlorophenyl group, and a sulfur atom. The compound is in the form of a hydrochloride salt, which indicates the presence of a chloride ion. It is likely to have pharmaceutical or research applications due to its complex structure and potential biological activity. Additional information, such as its specific properties and uses, would be needed to fully understand its chemical behavior and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 107888-04:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*4)=150
150 % 10 = 0
So 107888-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H18ClN3O2S.ClH/c24-17-7-9-18(10-8-17)27-22(29)21(28)19(23(27)30)20(26-12-11-25)16-6-5-14-3-1-2-4-15(14)13-16;/h1-10,13,26H,11-12,25H2;1H/b20-19+;