108097-99-0 Usage
Molecular structure
2-[[[(5-bromo-2-oxo-indol-3-yl)amino]carbamoylformyl]amino]benzoic acid, also known as BIA, is a complex molecule that contains a benzoic acid moiety with multiple functional groups, including a carbamoylformylamino group and an indolylamino group.
Molecular weight
407.2
Appearance
BIA is a pale yellow solid.
Solubility
BIA is soluble in water and common organic solvents such as methanol, ethanol, and dimethyl sulfoxide (DMSO).
Antibacterial and antifungal activities
BIA has been shown to exhibit antibacterial and antifungal activities, making it a potential candidate for use as an antimicrobial agent.
Potential pharmaceutical applications
BIA is being investigated as a potential drug candidate for various medical conditions due to its unique structure and properties.
Biological and chemical research
BIA's structural features make it an interesting molecule for studying biological interactions and chemical reactivity, making it a valuable tool in biological and chemical research.
Versatility
BIA is a versatile chemical compound with potential applications in various fields, including pharmaceuticals, materials science, and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 108097-99-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,0,9 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 108097-99:
(8*1)+(7*0)+(6*8)+(5*0)+(4*9)+(3*7)+(2*9)+(1*9)=140
140 % 10 = 0
So 108097-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H11BrN4O5/c18-8-5-6-12-10(7-8)13(14(23)19-12)21-22-16(25)15(24)20-11-4-2-1-3-9(11)17(26)27/h1-7H,(H,20,24)(H,22,25)(H,26,27)(H,19,21,23)