116423-07-5 Usage
General Description
3-(3,5-DIMETHYL-ISOXAZOL-4-YL)-PROPIONIC ACID is a chemical compound that is often used in the field of organic chemistry. It has the molecular formula C9H13NO3, which indicates that it is made up of nine carbon atoms, thirteen hydrogen atoms, one nitrogen atom, and three oxygen atoms. Its isoxazole ring, which is a five-membered ring consisting of three carbon atoms and one each of nitrogen and oxygen atoms, makes this chemical useful in the synthesis of pharmaceuticals and other active organic compounds. Its propionic acid moiety enhances its reactivity, playing a critical role in numerous reactions. It is known for its stability and effectiveness in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 116423-07-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,4,2 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 116423-07:
(8*1)+(7*1)+(6*6)+(5*4)+(4*2)+(3*3)+(2*0)+(1*7)=95
95 % 10 = 5
So 116423-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3/c1-5-7(3-4-8(10)11)6(2)12-9-5/h3-4H2,1-2H3,(H,10,11)/p-1
