119385-80-7 Usage
Description
3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID is an organic compound characterized by the presence of an amino group attached to the third carbon atom and three fluorine atoms on the second, fourth, and fifth carbon atoms of a benzoic acid structure. 3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID is used as a chemical intermediate for the synthesis of 7-(azaspiroalkanyl)quinolonecarboxylates and their analogs. These compounds exhibit bactericidal properties, making them valuable in the development of new antibiotics to combat bacterial infections.
In the context of the pharmaceutical industry, 3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID plays a crucial role in the preparation of novel bactericides. The compound serves as a key building block in the synthesis of 7-(azaspiroalkanyl)quinolonecarboxylates and their analogs, which have demonstrated potent bactericidal activity. This makes them promising candidates for the development of new antibiotics, particularly in the face of increasing antibiotic resistance. By incorporating 3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID into their molecular structure, these compounds can effectively target and eliminate harmful bacteria, providing a potential solution to the growing problem of antibiotic resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 119385-80-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,3,8 and 5 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 119385-80:
(8*1)+(7*1)+(6*9)+(5*3)+(4*8)+(3*5)+(2*8)+(1*0)=147
147 % 10 = 7
So 119385-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F3NO2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,11H2,(H,12,13)
119385-80-7Relevant articles and documents
Preparation method of 3-chloro-2,4,5-trifluorobenzoic acid
-
Paragraph 5; 6, (2019/12/29)
The invention discloses a preparation method of 3-chloro-2,4,5-trifluorobenzoic acid. The reaction equation of the method is shown in the description. The preparation method concretely comprises the following steps: preparing a compound of formula (1) fro
Process for the synthesis of 3-chloro-2,4,5-trifluorobenzoic acid
-
, (2008/06/13)
An improved process for the preparation of 3-chloro-2,4,5-trifluorobenzoic acid is described which involves reaction of a diester of 3,4,5,6-tetrafluoro-1,2-benzenedicarboxylic acid with a substituted amine to afford 3-amino-2,4,5-trifluorobenzoic acid followed by subsequent conversion of the amio intermediate into 3-chloro-2,4,5-trifluorobenzoic acid.