119750-12-8 Usage
Description
2-CHLORO-N-(2,3-DIHYDRO-1,4-BENZODIOXIN-2-YLMETHYL)ACETAMIDE, also known as Venlafaxine Impurity F, is a chemical compound that serves as an intermediate in the synthesis of the pharmaceutical drug venlafaxine. Classified as an acetamide, this compound features a chlorine atom and a benzodioxin ring in its molecular structure, playing a crucial role in pharmaceutical research and development, especially in the production of antidepressant medications.
Uses
Used in Pharmaceutical Industry:
2-CHLORO-N-(2,3-DIHYDRO-1,4-BENZODIOXIN-2-YLMETHYL)ACETAMIDE is used as a chemical intermediate for the synthesis of venlafaxine, an antidepressant medication. Its unique structure, including the chlorine atom and benzodioxin ring, contributes to the development of effective treatments for depression and related disorders.
It is essential to handle 2-CHLORO-N-(2,3-DIHYDRO-1,4-BENZODIOXIN-2-YLMETHYL)ACETAMIDE with care and adhere to proper safety protocols to minimize potential health hazards associated with its use in pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 119750-12-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,7,5 and 0 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 119750-12:
(8*1)+(7*1)+(6*9)+(5*7)+(4*5)+(3*0)+(2*1)+(1*2)=128
128 % 10 = 8
So 119750-12-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12ClNO3/c12-5-11(14)13-6-8-7-15-9-3-1-2-4-10(9)16-8/h1-4,8H,5-7H2,(H,13,14)/t8-/m1/s1
