139953-73-4 Usage
Description
Cyclazosin is a monocarboxylic acid amide that is formed through the formal condensation of the carboxy group of furoic acid with the secondary amino group of 6,7-dimethoxy-2-[(4aR,8aS)-octahydroquinoxalin-1-yl]quinazolin-4-amine. It is a chemical compound with potential applications in various industries due to its unique structure and properties.
Uses
Used in Pharmaceutical Industry:
Cyclazosin is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs to treat various medical conditions.
Used in Chemical Research:
In the field of chemical research, cyclazosin serves as a valuable compound for studying the properties and reactivity of monocarboxylic acid amides. Its synthesis and characterization can provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
Cyclazosin's unique structure and properties may also find applications in material science. It could potentially be used in the development of new materials with specific properties, such as improved strength, flexibility, or chemical resistance, depending on its interaction with other compounds and its stability under various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 139953-73-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,9,5 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 139953-73:
(8*1)+(7*3)+(6*9)+(5*9)+(4*5)+(3*3)+(2*7)+(1*3)=174
174 % 10 = 4
So 139953-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H27N5O4/c1-30-19-12-14-15(13-20(19)31-2)25-23(26-21(14)24)28-10-9-27(16-6-3-4-7-17(16)28)22(29)18-8-5-11-32-18/h5,8,11-13,16-17H,3-4,6-7,9-10H2,1-2H3,(H2,24,25,26)/t16-,17+/m0/s1
139953-73-4Relevant articles and documents
Synthesis and α1-adrenoceptor antagonist activity of derivatives and isosters of the furan portion of (+)-cyclazosin
Sagratini, Gianni,Angeli, Piero,Buccioni, Michela,Gulini, Ugo,Marucci, Gabriella,Melchiorre, Carlo,Leonardi, Amedeo,Poggesi, Elena,Giardina, Dario
, p. 2334 - 2345 (2007)
α1-Adrenoceptor selective antagonists are crucial in investigating the role and biological functions of α1-adrenoceptor subtypes. We synthesized and studied the α1-adrenoceptor blocking properties of new molecules structur