14328-62-2 Usage
General Description
L-Cyclopentyl-gly-methyl ester HCL is a type of chemical compound that falls under the category of organic compounds. It contains cyclopentyl, which is a cycloalkane with a chemical formula C5H9, while gly is a short form of glycine which is the simplest possible amino acid in chemistry and biochemistry. The 'methyl ester' refers to its specific ester group (-COOCH3) which is connected to the rest of the molecule. The 'HCL' at the end indicates that this compound is in its hydrochloride form, a common form for substances used in pharmaceuticals or as chemical reagents. Therefore, this compound likely serves a significant role in chemical reactions due to its specific functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 14328-62-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,3,2 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 14328-62:
(7*1)+(6*4)+(5*3)+(4*2)+(3*8)+(2*6)+(1*2)=92
92 % 10 = 2
So 14328-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2.ClH/c1-11-8(10)7(9)6-4-2-3-5-6;/h6-7H,2-5,9H2,1H3;1H/t7-;/m0./s1