148519-95-3 Usage
General Description
(3-iodobenzyl)trozamicol is a chemical compound that belongs to the trozamicol family. It is a derivative of trozamicol, a synthetic compound known for its potential as a cognitive enhancer and memory booster. The addition of an iodine atom to the benzene ring in (3-iodobenzyl)trozamicol gives the compound specific properties and potential applications in pharmaceutical research and drug development. This chemical may have potential pharmacological properties due to its structural similarity to trozamicol, and its synthesis and characterization could provide valuable insights for the development of new therapeutic agents in the field of cognitive enhancement and neuropharmacology. Further research is needed to fully understand the potential uses and effects of (3-iodobenzyl)trozamicol.
Check Digit Verification of cas no
The CAS Registry Mumber 148519-95-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,5,1 and 9 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 148519-95:
(8*1)+(7*4)+(6*8)+(5*5)+(4*1)+(3*9)+(2*9)+(1*5)=163
163 % 10 = 3
So 148519-95-3 is a valid CAS Registry Number.
InChI:InChI=1/C23H29IN2O/c24-21-8-4-5-18(15-21)16-25-12-11-23(27)22(17-25)26-13-9-20(10-14-26)19-6-2-1-3-7-19/h1-8,15,20,22-23,27H,9-14,16-17H2/t22-,23-/m0/s1
148519-95-3Relevant articles and documents
Nonsymmetrical bipiperidyls as inhibitors of vesicular acetylcholine storage
Efange,Khare,Parsons,Bau,Metzenthin
, p. 985 - 989 (1993)
Introduction of a nitrogen atom into the cyclohexane ring of 2-(4- phenylpiperidinyl)cyclohexanol (vesamicol, AH5183) yielded two positional isomers, 5-azavesamicol (5, prezamicol) and 4-azavesamicol (6, trozamicol). As inhibitors of vesicular acetylcholi