176442-21-0 Usage
Description
3-[(9H-Fluoren-9-ylmethoxy)carbonyl]amino-5-hydroxybenzoic acid is a complex organic compound that features a fluorene derivative connected to an amino acid and a hydroxybenzoic acid moiety. This unique structure, which includes a fluorenylmethoxy carbonyl group, an amino group, and a hydroxybenzoic acid group, suggests potential applications in various fields, particularly in pharmaceuticals and industry, due to its distinct chemical properties. Further research is essential to explore the full spectrum of its capabilities and effects.
Uses
Used in Pharmaceutical Industry:
3-[(9H-Fluoren-9-ylmethoxy)carbonyl]amino-5-hydroxybenzoic acid is used as a potential pharmaceutical compound for its unique structural features that may offer specific biological activities. The presence of the fluorenylmethoxy carbonyl and hydroxybenzoic acid groups could provide this molecule with properties that are beneficial for drug development, such as enhancing solubility, stability, or bioavailability.
Used in Chemical Synthesis:
In the chemical synthesis industry, 3-[(9H-Fluoren-9-ylmethoxy)carbonyl]amino-5-hydroxybenzoic acid may serve as a building block or intermediate in the creation of more complex molecules. Its versatile structure allows for further functionalization and modification, making it a valuable component in the synthesis of advanced materials or specialty chemicals.
Used in Material Science:
3-[(9H-Fluoren-9-ylmethoxy)carbonyl]amino-5-hydroxybenzoic acid could be utilized in material science for the development of new polymers or coatings. The fluorene and hydroxybenzoic acid components may contribute to the compound's ability to form stable and functional materials with specific properties, such as improved thermal stability or resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 176442-21-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,4,4 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 176442-21:
(8*1)+(7*7)+(6*6)+(5*4)+(4*4)+(3*2)+(2*2)+(1*1)=140
140 % 10 = 0
So 176442-21-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H17NO5/c24-15-10-13(21(25)26)9-14(11-15)23-22(27)28-12-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-11,20,24H,12H2,(H,23,27)(H,25,26)
176442-21-0Relevant articles and documents
A scaleable method for preparing 3-fluorenylmethoxycarbonylamino-5- hydroxybenzoic acid
Watson,Flynn,Shah
, p. 1379 - 1382 (1999)
A scaleable synthesis of 3-fluorenylmethoxycarbonylamino-5- hydroxybenzoic acid is described.